C25H36O3Si — CID 91183164
(8S,9S,10S,13S,14S,17R)-1,13-dimethyl-3-oxo-17-(2-trimethylsilyloxyethynyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 91183164) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17R)-1,13-dimethyl-3-oxo-17-(2-trimethylsilyloxyethynyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8S,9S,10S,13S,14S,17R)-1,13-dimethyl-3-oxo-17-(2-trimethylsilyloxyethynyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 91183164 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (8S,9S,10S,13S,14S,17R)-1,13-dimethyl-3-oxo-17-(2-trimethylsilyloxyethynyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@@H](C#CO[Si](C)(C)C)[C@@]4(C)CC[C@@H]3[C@]21C=O |
| InChI | InChI=1S/C25H36O3Si/c1-17-14-20(27)15-19-6-8-21-22-9-7-18(11-13-28-29(3,4)5)24(22,2)12-10-23(21)25(17,19)16-26/h15-18,21-23H,6-10,12,14H2,1-5H3/t17?,18-,21-,22-,23-,24+,25-/m0/s1 |
| InChIKey | AHNKVLFAWOAMAH-OKAWSYFLSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|