C23H32O2 — CID 89044750
(10R,13S,17S)-17-acetyl-1,10,13-trimethyl-11-methylidene-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 89044750) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (10R,13S,17S)-17-acetyl-1,10,13-trimethyl-11-methylidene-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17S)-17-acetyl-1,10,13-trimethyl-11-methylidene-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 89044750 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (10R,13S,17S)-17-acetyl-1,10,13-trimethyl-11-methylidene-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@@]2(C)C(CC[C@@H]2C(C)=O)C2CCC3=CC(=O)CC(C)[C@]3(C)C12 |
| InChI | InChI=1S/C23H32O2/c1-13-12-22(4)19(15(3)24)8-9-20(22)18-7-6-16-11-17(25)10-14(2)23(16,5)21(13)18/h11,14,18-21H,1,6-10,12H2,2-5H3/t14?,18?,19-,20?,21?,22-,23+/m1/s1 |
| InChIKey | LUIGSCYWEDNMKH-SBLZAACBSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|