C25H32O2 — CID 143827853
(3'S,5'S,7'S)-18'-ethenyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one (PubChem CID 143827853) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is (3'S,5'S,7'S)-18'-ethenyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one.
| Compound Name | (3'S,5'S,7'S)-18'-ethenyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
|---|---|
| PubChem CID | 143827853 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3'S,5'S,7'S)-18'-ethenyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
| SMILES | C=CC1CC2=CC(=O)CCC2C2CC[C@@]3(CC)C(C12)C1C[C@@H]1C31C=CCO1 |
| InChI | InChI=1S/C25H32O2/c1-3-15-12-16-13-17(26)6-7-18(16)19-8-10-24(4-2)23(22(15)19)20-14-21(20)25(24)9-5-11-27-25/h3,5,9,13,15,18-23H,1,4,6-8,10-12,14H2,2H3/t15?,18?,19?,20?,21-,22?,23?,24-,25?/m0/s1 |
| InChIKey | IQQWRIBUEUKLJF-LQZKAFEXSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|