C22H26O3 — CID 143827580
(13S)-13-ethylspiro[1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione (PubChem CID 143827580) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (13S)-13-ethylspiro[1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione.
| Compound Name | (13S)-13-ethylspiro[1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
|---|---|
| PubChem CID | 143827580 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (13S)-13-ethylspiro[1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
| SMILES | CC[C@]12CCC3C4CCC(=O)C=C4C=CC3C1CCC21C=CC(=O)O1 |
| InChI | InChI=1S/C22H26O3/c1-2-21-10-7-17-16-6-4-15(23)13-14(16)3-5-18(17)19(21)8-11-22(21)12-9-20(24)25-22/h3,5,9,12-13,16-19H,2,4,6-8,10-11H2,1H3/t16?,17?,18?,19?,21-,22?/m0/s1 |
| InChIKey | IECGUXKNALUNRX-QKFMXRBCSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |