C25H35NO3 — CID 158896777
(10R,13S,17R)-7-cyclopropyl-13-ethyl-3-iminospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one;hydrate (PubChem CID 158896777) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (10R,13S,17R)-7-cyclopropyl-13-ethyl-3-iminospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one;hydrate.
| Compound Name | (10R,13S,17R)-7-cyclopropyl-13-ethyl-3-iminospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one;hydrate |
|---|---|
| PubChem CID | 158896777 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (10R,13S,17R)-7-cyclopropyl-13-ethyl-3-iminospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one;hydrate |
| SMILES | O.[H]/N=C1/C=C2CC(C3CC3)C3C(CC[C@@]4(CC)C3CC[C@@]43C=CC(=O)O3)[C@H]2CC1 |
| InChI | InChI=1S/C25H33NO2.H2O/c1-2-24-10-7-19-18-6-5-17(26)13-16(18)14-20(15-3-4-15)23(19)21(24)8-11-25(24)12-9-22(27)28-25;/h9,12-13,15,18-21,23,26H,2-8,10-11,14H2,1H3;1H2/b26-17+;/t18-,19?,20?,21?,23?,24-,25+;/m0./s1 |
| InChIKey | QXLDQRYLZAUZQI-UZXSMEJJSA-N |
| XLogP | 4.63 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|