C23H28O3 — CID 58115335
(10R,13S,17R)-7-ethenyl-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione (PubChem CID 58115335) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (10R,13S,17R)-7-ethenyl-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione.
| Compound Name | (10R,13S,17R)-7-ethenyl-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
|---|---|
| PubChem CID | 58115335 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (10R,13S,17R)-7-ethenyl-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
| SMILES | C=CC1CC2=CC(=O)CC[C@@H]2C2CC[C@@]3(C)C(CC[C@@]34C=CC(=O)O4)C12 |
| InChI | InChI=1S/C23H28O3/c1-3-14-12-15-13-16(24)4-5-17(15)18-6-9-22(2)19(21(14)18)7-10-23(22)11-8-20(25)26-23/h3,8,11,13-14,17-19,21H,1,4-7,9-10,12H2,2H3/t14?,17-,18?,19?,21?,22-,23+/m0/s1 |
| InChIKey | NPQJUXZKYVHMNY-SHWFBYHASA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|