C26H33N3O2 — CID 167089386
(7S,13S,17S)-17-(1-but-3-ynyltriazol-4-yl)-7-ethenyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 167089386) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (7S,13S,17S)-17-(1-but-3-ynyltriazol-4-yl)-7-ethenyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,13S,17S)-17-(1-but-3-ynyltriazol-4-yl)-7-ethenyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 167089386 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (7S,13S,17S)-17-(1-but-3-ynyltriazol-4-yl)-7-ethenyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#CCCn1cc([C@]2(O)CCC3C4C(C=C)CC5=CC(=O)CCC5C4CC[C@@]32C)nn1 |
| InChI | InChI=1S/C26H33N3O2/c1-4-6-13-29-16-23(27-28-29)26(31)12-10-22-24-17(5-2)14-18-15-19(30)7-8-20(18)21(24)9-11-25(22,26)3/h1,5,15-17,20-22,24,31H,2,6-14H2,3H3/t17?,20?,21?,22?,24?,25-,26+/m0/s1 |
| InChIKey | MHGQNEDAHGVMDS-BFIAKMLKSA-N |
| XLogP | 4.04 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|