C25H37N3O2 — CID 90049351
(10R,13S,17S)-17-(1-butyltriazol-4-yl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 90049351) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (10R,13S,17S)-17-(1-butyltriazol-4-yl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17S)-17-(1-butyltriazol-4-yl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90049351 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (10R,13S,17S)-17-(1-butyltriazol-4-yl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCn1cc([C@]2(O)CCC3C4CCC5=CC(=O)CC[C@]5(C)C4CC[C@@]32C)nn1 |
| InChI | InChI=1S/C25H37N3O2/c1-4-5-14-28-16-22(26-27-28)25(30)13-10-21-19-7-6-17-15-18(29)8-11-23(17,2)20(19)9-12-24(21,25)3/h15-16,19-21,30H,4-14H2,1-3H3/t19?,20?,21?,23-,24-,25+/m0/s1 |
| InChIKey | YRMCJWCJVQUBNR-KVNPHLGMSA-N |
| XLogP | 4.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |