C27H40N4O3 — CID 90049388
[(3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 90049388) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 90049388 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | [(3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCCCn1cc([C@]2(OC(C)=O)CCC3C4CCC5=C/C(=N\O)CC[C@]5(C)C4CC[C@@]32C)nn1 |
| InChI | InChI=1S/C27H40N4O3/c1-5-6-15-31-17-24(28-30-31)27(34-18(2)32)14-11-23-21-8-7-19-16-20(29-33)9-12-25(19,3)22(21)10-13-26(23,27)4/h16-17,21-23,33H,5-15H2,1-4H3/b29-20-/t21?,22?,23?,25-,26-,27+/m0/s1 |
| InChIKey | POXUTCXTDDBIOR-FLSKMFOBSA-N |
| XLogP | 5.63 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|