C25H38N4O2 — CID 90049353
(3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 90049353) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is (3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 90049353 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (3Z,10R,13S,17S)-17-(1-butyltriazol-4-yl)-3-hydroxyimino-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CCCCn1cc([C@]2(O)CCC3C4CCC5=C/C(=N\O)CC[C@]5(C)C4CC[C@@]32C)nn1 |
| InChI | InChI=1S/C25H38N4O2/c1-4-5-14-29-16-22(26-28-29)25(30)13-10-21-19-7-6-17-15-18(27-31)8-11-23(17,2)20(19)9-12-24(21,25)3/h15-16,19-21,30-31H,4-14H2,1-3H3/b27-18-/t19?,20?,21?,23-,24-,25+/m0/s1 |
| InChIKey | XWHFQSANZAIUOG-PNGREOMESA-N |
| XLogP | 5.06 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|