C26H41N5O2 — CID 123914931
3-[2-[4-[(dimethylamino)methyl]triazol-1-yl]ethoxyimino]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 123914931) has the molecular formula C26H41N5O2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 3-[2-[4-[(dimethylamino)methyl]triazol-1-yl]ethoxyimino]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | 3-[2-[4-[(dimethylamino)methyl]triazol-1-yl]ethoxyimino]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123914931 |
| Molecular Formula | C26H41N5O2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | 3-[2-[4-[(dimethylamino)methyl]triazol-1-yl]ethoxyimino]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CN(C)Cc1cn(CCON=C2C=C3CCC4C(CCC5(C)C(O)CCC45)C3(C)CC2)nn1 |
| InChI | InChI=1S/C26H41N5O2/c1-25-11-9-19(28-33-14-13-31-17-20(27-29-31)16-30(3)4)15-18(25)5-6-21-22-7-8-24(32)26(22,2)12-10-23(21)25/h15,17,21-24,32H,5-14,16H2,1-4H3 |
| InChIKey | FDIOXOFFMMFCKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|