C24H37N3O3 — CID 123413680
10,13-dimethyl-3-[2-(3-methyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 123413680) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is 10,13-dimethyl-3-[2-(3-methyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | 10,13-dimethyl-3-[2-(3-methyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123413680 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 10,13-dimethyl-3-[2-(3-methyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)ethoxyimino]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC1=NC(CCON=C2C=C3CCC4C(CCC5(C)C(O)CCC45)C3(C)CC2)ON1 |
| InChI | InChI=1S/C24H37N3O3/c1-15-25-22(30-26-15)10-13-29-27-17-8-11-23(2)16(14-17)4-5-18-19-6-7-21(28)24(19,3)12-9-20(18)23/h14,18-22,28H,4-13H2,1-3H3,(H,25,26) |
| InChIKey | QMYXDJGTIRSFHH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|