C24H36N2O6 — CID 171141022
3-hydroxy-2-[[2-[[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid (PubChem CID 171141022) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-[[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[2-[[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171141022 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 3-hydroxy-2-[[2-[[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid |
| SMILES | C[C@]12CCC3C(CCC4=CC(=NOCC(=O)NC(CO)C(=O)O)CC[C@@]43C)C1CCC2O |
| InChI | InChI=1S/C24H36N2O6/c1-23-9-7-15(26-32-13-21(29)25-19(12-27)22(30)31)11-14(23)3-4-16-17-5-6-20(28)24(17,2)10-8-18(16)23/h11,16-20,27-28H,3-10,12-13H2,1-2H3,(H,25,29)(H,30,31)/t16?,17?,18?,19?,20?,23-,24-/m0/s1 |
| InChIKey | DZPROHKVTKFBQP-TTZXZBAVSA-N |
| XLogP | 2.24 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|