C26H39N3O6 — CID 124905883
(2R)-5-amino-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-5-oxopentanoic acid (PubChem CID 124905883) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is (2R)-5-amino-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 124905883 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (2R)-5-amino-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@]12CC[C@@H]3[C@H](CCC4=CC(=NOCC(=O)N[C@H](CCC(N)=O)C(=O)O)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C26H39N3O6/c1-25-11-9-16(29-35-14-23(32)28-20(24(33)34)6-8-22(27)31)13-15(25)3-4-17-18-5-7-21(30)26(18,2)12-10-19(17)25/h13,17-21,30H,3-12,14H2,1-2H3,(H2,27,31)(H,28,32)(H,33,34)/t17-,18+,19-,20-,21+,25+,26+/m1/s1 |
| InChIKey | UFLLAIAWPSWXOC-KRCXLNHCSA-N |
| XLogP | 2.52 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|