C26H40N2O5 — CID 124905645
(2S)-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-methylbutanoic acid (PubChem CID 124905645) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is (2S)-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 124905645 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | (2S)-2-[[2-[[(8S,9R,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CON=C1C=C2CC[C@H]3[C@@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)[C@@]2(C)CC1)C(=O)O |
| InChI | InChI=1S/C26H40N2O5/c1-15(2)23(24(31)32)27-22(30)14-33-28-17-9-11-25(3)16(13-17)5-6-18-19-7-8-21(29)26(19,4)12-10-20(18)25/h13,15,18-21,23,29H,5-12,14H2,1-4H3,(H,27,30)(H,31,32)/t18-,19+,20-,21+,23+,25+,26+/m1/s1 |
| InChIKey | LTZTXAMQQZBEQH-NNKXPPFYSA-N |
| XLogP | 3.91 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|