C30H45N3O6 — CID 135639731
2-[[2-[[2-[(Z)-[(10R,13S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]acetyl]amino]-3-methylbutanoic acid (PubChem CID 135639731) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is 2-[[2-[[2-[(Z)-[(10R,13S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(Z)-[(10R,13S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 135639731 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 2-[[2-[[2-[(Z)-[(10R,13S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)C1CCC2C3CCC4=C/C(=N\OCC(=O)NCC(=O)NC(C(=O)O)C(C)C)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C30H45N3O6/c1-17(2)27(28(37)38)32-25(35)15-31-26(36)16-39-33-20-10-12-29(4)19(14-20)6-7-21-23-9-8-22(18(3)34)30(23,5)13-11-24(21)29/h14,17,21-24,27H,6-13,15-16H2,1-5H3,(H,31,36)(H,32,35)(H,37,38)/b33-20-/t21?,22?,23?,24?,27?,29-,30+/m0/s1 |
| InChIKey | LIJRFLZASLDFJY-NEHMXDEBSA-N |
| XLogP | 3.87 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|