C33H44N2O5 — CID 124905459
(3S)-4-[[2-[[(8S,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylbutanoic acid (PubChem CID 124905459) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is (3S)-4-[[2-[[(8S,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylbutanoic acid.
| Compound Name | (3S)-4-[[2-[[(8S,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 124905459 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | (3S)-4-[[2-[[(8S,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylbutanoic acid |
| SMILES | CC(=O)[C@@H]1CC[C@@H]2[C@@H]3CCC4=CC(=NOCC(=O)NC[C@@H](CC(=O)O)c5ccccc5)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C33H44N2O5/c1-21(36)27-11-12-28-26-10-9-24-18-25(13-15-32(24,2)29(26)14-16-33(27,28)3)35-40-20-30(37)34-19-23(17-31(38)39)22-7-5-4-6-8-22/h4-8,18,23,26-29H,9-17,19-20H2,1-3H3,(H,34,37)(H,38,39)/t23-,26+,27+,28-,29-,32+,33-/m1/s1 |
| InChIKey | APYIVIUDKTVWSJ-NWWBNWMXSA-N |
| XLogP | 5.90 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|