C31H42N2O5 — CID 74808648
4-[[2-[(17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-phenylbutanoic acid (PubChem CID 74808648) has the molecular formula C31H42N2O5 and a molecular weight of 522.69 g/mol. Its IUPAC name is 4-[[2-[(17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-phenylbutanoic acid.
| Compound Name | 4-[[2-[(17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 74808648 |
| Molecular Formula | C31H42N2O5 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 4-[[2-[(17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-phenylbutanoic acid |
| SMILES | CC12CCC(=NOCC(=O)NCC(CC(=O)O)c3ccccc3)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C31H42N2O5/c1-30-14-12-23(17-22(30)8-9-24-25-10-11-27(34)31(25,2)15-13-26(24)30)33-38-19-28(35)32-18-21(16-29(36)37)20-6-4-3-5-7-20/h3-7,17,21,24-27,34H,8-16,18-19H2,1-2H3,(H,32,35)(H,36,37) |
| InChIKey | KQGBJEZYOYEOPW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|