C27H37N3O3 — CID 42648561
2-[(Z)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 42648561) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-[(Z)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[(Z)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42648561 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 2-[(Z)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | C[C@]12CCC3C(CCC4=C/C(=N\OCC(=O)NCc5ccccn5)CC[C@@]43C)C1CCC2O |
| InChI | InChI=1S/C27H37N3O3/c1-26-12-10-19(30-33-17-25(32)29-16-20-5-3-4-14-28-20)15-18(26)6-7-21-22-8-9-24(31)27(22,2)13-11-23(21)26/h3-5,14-15,21-24,31H,6-13,16-17H2,1-2H3,(H,29,32)/b30-19-/t21?,22?,23?,24?,26-,27-/m0/s1 |
| InChIKey | BGGUBFNGVWSMLV-GNCGLJOCSA-N |
| XLogP | 4.39 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|