C28H43N3O2 — CID 159059214
N,N-dimethyl-1-[2-[2-[[(10R,13R,17S)-10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyethyl]-1,3-oxazol-5-yl]methanamine (PubChem CID 159059214) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[2-[[(10R,13R,17S)-10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyethyl]-1,3-oxazol-5-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-[2-[[(10R,13R,17S)-10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyethyl]-1,3-oxazol-5-yl]methanamine |
|---|---|
| PubChem CID | 159059214 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | N,N-dimethyl-1-[2-[2-[[(10R,13R,17S)-10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyethyl]-1,3-oxazol-5-yl]methanamine |
| SMILES | C[C@H]1CCC2C3CCC4=CC(=NOCCc5ncc(CN(C)C)o5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H43N3O2/c1-19-6-9-24-23-8-7-20-16-21(10-13-28(20,3)25(23)11-14-27(19,24)2)30-32-15-12-26-29-17-22(33-26)18-31(4)5/h16-17,19,23-25H,6-15,18H2,1-5H3/t19-,23?,24?,25?,27+,28-/m0/s1 |
| InChIKey | JYGBVJGNHVYJCX-CFHZPTRMSA-N |
| XLogP | 6.25 |
| TPSA | 50.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|