C27H39N3O3 — CID 123772849
(10R,13S)-3-[2-[2-[(dimethylamino)methyl]-1,3-oxazol-5-yl]ethoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123772849) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is (10R,13S)-3-[2-[2-[(dimethylamino)methyl]-1,3-oxazol-5-yl]ethoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (10R,13S)-3-[2-[2-[(dimethylamino)methyl]-1,3-oxazol-5-yl]ethoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123772849 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | (10R,13S)-3-[2-[2-[(dimethylamino)methyl]-1,3-oxazol-5-yl]ethoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(C)Cc1ncc(CCON=C2C=C3CCC4C(CC[C@]5(C)C(=O)CCC45)[C@@]3(C)CC2)o1 |
| InChI | InChI=1S/C27H39N3O3/c1-26-12-9-19(29-32-14-11-20-16-28-25(33-20)17-30(3)4)15-18(26)5-6-21-22-7-8-24(31)27(22,2)13-10-23(21)26/h15-16,21-23H,5-14,17H2,1-4H3/t21?,22?,23?,26-,27-/m0/s1 |
| InChIKey | QAZMRZKMOXZKHD-BPYUCTHPSA-N |
| XLogP | 5.18 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|