C21H28NNaO4 — CID 172854426
sodium 2-[[(8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate (PubChem CID 172854426) has the molecular formula C21H28NNaO4 and a molecular weight of 381.45 g/mol. Its IUPAC name is sodium 2-[[(8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate.
| Compound Name | sodium 2-[[(8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 172854426 |
| Molecular Formula | C21H28NNaO4 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | sodium 2-[[(8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
| SMILES | C[C@]12CCC(=NOCC(=O)[O-])C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.[Na+] |
| InChI | InChI=1S/C21H29NO4.Na/c1-20-9-7-14(22-26-12-19(24)25)11-13(20)3-4-15-16-5-6-18(23)21(16,2)10-8-17(15)20;/h11,15-17H,3-10,12H2,1-2H3,(H,24,25);/q;+1/p-1/t15-,16-,17-,20-,21-;/m0./s1 |
| InChIKey | YMSNYAKKFIGFFD-UZLSGBRFSA-M |
| XLogP | -0.36 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|