C24H34NO5- — CID 11873285
2-[[(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-17-propanoyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate (PubChem CID 11873285) has the molecular formula C24H34NO5- and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-[[(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-17-propanoyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate.
| Compound Name | 2-[[(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-17-propanoyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 11873285 |
| Molecular Formula | C24H34NO5- |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[[(8S,9R,10R,13S,14R,17S)-10,13-dimethyl-17-propanoyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
| SMILES | CCC(=O)O[C@H]1CC[C@@H]2[C@H]3CCC4=CC(=NOCC(=O)[O-])CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C24H35NO5/c1-4-22(28)30-20-8-7-18-17-6-5-15-13-16(25-29-14-21(26)27)9-11-23(15,2)19(17)10-12-24(18,20)3/h13,17-20H,4-12,14H2,1-3H3,(H,26,27)/p-1/t17-,18-,19-,20+,23+,24+/m1/s1 |
| InChIKey | ZXQPFGVRKHFTFV-FVLVKUNMSA-M |
| XLogP | 3.39 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|