C26H39N5O2 — CID 88916352
(3Z,10R,13S)-3-[4-[4-(aminomethyl)triazol-1-yl]butoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 88916352) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is (3Z,10R,13S)-3-[4-[4-(aminomethyl)triazol-1-yl]butoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3Z,10R,13S)-3-[4-[4-(aminomethyl)triazol-1-yl]butoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 88916352 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | (3Z,10R,13S)-3-[4-[4-(aminomethyl)triazol-1-yl]butoxyimino]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC/C(=N/OCCCCn3cc(CN)nn3)C=C1CCC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C26H39N5O2/c1-25-11-9-19(29-33-14-4-3-13-31-17-20(16-27)28-30-31)15-18(25)5-6-21-22-7-8-24(32)26(22,2)12-10-23(21)25/h15,17,21-23H,3-14,16,27H2,1-2H3/b29-19-/t21?,22?,23?,25-,26-/m0/s1 |
| InChIKey | GTCUFWJPCKZSBQ-YLYNATJXSA-N |
| XLogP | 4.42 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|