C26H36N2O5 — CID 172983012
(2,5-dioxopyrrolidin-1-yl) 2-[(E)-(10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetate (PubChem CID 172983012) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(E)-(10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(E)-(10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetate |
|---|---|
| PubChem CID | 172983012 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(E)-(10,13,17-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetate |
| SMILES | CC1CCC2C3CCC4=C/C(=N/OCC(=O)ON5C(=O)CCC5=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H36N2O5/c1-16-4-7-20-19-6-5-17-14-18(10-12-26(17,3)21(19)11-13-25(16,20)2)27-32-15-24(31)33-28-22(29)8-9-23(28)30/h14,16,19-21H,4-13,15H2,1-3H3/b27-18+ |
| InChIKey | YQDKMZBFLMOGKU-OVVQPSECSA-N |
| XLogP | 4.57 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|