C26H36N2O6 — CID 95371873
(2,5-dioxopyrrolidin-1-yl) 2-[(Z)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate (PubChem CID 95371873) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(Z)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(Z)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 95371873 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(Z)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetate |
| SMILES | C[C@]12CC/C(=N/OCC(=O)ON3C(=O)CCC3=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C26H36N2O6/c1-24-11-8-17(27-33-15-23(31)34-28-21(29)6-7-22(28)30)14-16(24)4-5-18-19(24)9-12-25(2)20(18)10-13-26(25,3)32/h14,18-20,32H,4-13,15H2,1-3H3/b27-17-/t18-,19+,20+,24+,25+,26+/m1/s1 |
| InChIKey | JNTPTHFPUSDLKD-FETWDGRWSA-N |
| XLogP | 3.68 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|