C25H38N2O6 — CID 94849237
(2R)-3-hydroxy-2-[[2-[(E)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid (PubChem CID 94849237) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[2-[(E)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[2-[(E)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 94849237 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2R)-3-hydroxy-2-[[2-[(E)-[(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]propanoic acid |
| SMILES | C[C@]12CC/C(=N\OCC(=O)N[C@H](CO)C(=O)O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C25H38N2O6/c1-23-9-6-16(27-33-14-21(29)26-20(13-28)22(30)31)12-15(23)4-5-17-18(23)7-10-24(2)19(17)8-11-25(24,3)32/h12,17-20,28,32H,4-11,13-14H2,1-3H3,(H,26,29)(H,30,31)/b27-16+/t17-,18+,19+,20-,23+,24+,25+/m1/s1 |
| InChIKey | XTKJCJCPPRSNNR-XQIFPERBSA-N |
| XLogP | 2.63 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|