C30H38N2O3S — CID 53461693
17-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 53461693) has the molecular formula C30H38N2O3S and a molecular weight of 506.71 g/mol. Its IUPAC name is 17-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53461693 |
| Molecular Formula | C30H38N2O3S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 17-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCOc1ccc(Nc2nc(C3(O)CCC4C5CCC6=CC(=O)CCC6(C)C5CCC43C)cs2)cc1 |
| InChI | InChI=1S/C30H38N2O3S/c1-4-35-22-8-6-20(7-9-22)31-27-32-26(18-36-27)30(34)16-13-25-23-10-5-19-17-21(33)11-14-28(19,2)24(23)12-15-29(25,30)3/h6-9,17-18,23-25,34H,4-5,10-16H2,1-3H3,(H,31,32) |
| InChIKey | TVNWBUGGIJNWIX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |