C26H41O6P — CID 4554572
17-(3-diethoxyphosphorylpropanoyl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 4554572) has the molecular formula C26H41O6P and a molecular weight of 480.58 g/mol. Its IUPAC name is 17-(3-diethoxyphosphorylpropanoyl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(3-diethoxyphosphorylpropanoyl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 4554572 |
| Molecular Formula | C26H41O6P |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 17-(3-diethoxyphosphorylpropanoyl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCOP(=O)(CCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C)OCC |
| InChI | InChI=1S/C26H41O6P/c1-5-31-33(30,32-6-2)16-12-23(28)26(29)15-11-22-20-8-7-18-17-19(27)9-13-24(18,3)21(20)10-14-25(22,26)4/h17,20-22,29H,5-16H2,1-4H3 |
| InChIKey | OWUUODNSAQJSJN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|