C21H31O7P — CID 172873920
[2-[(8R,9S,10S,13R,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate (PubChem CID 172873920) has the molecular formula C21H31O7P and a molecular weight of 426.45 g/mol. Its IUPAC name is [2-[(8R,9S,10S,13R,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate.
| Compound Name | [2-[(8R,9S,10S,13R,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 172873920 |
| Molecular Formula | C21H31O7P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [2-[(8R,9S,10S,13R,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] dihydrogen phosphate |
| SMILES | C[C@@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H]1CC[C@]2(O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C21H31O7P/c1-19-8-5-14(22)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,24)18(23)12-28-29(25,26)27/h11,15-17,24H,3-10,12H2,1-2H3,(H2,25,26,27)/t15-,16+,17+,19-,20-,21+/m1/s1 |
| InChIKey | NVDJORDAHOURAX-IPTGWOMKSA-N |
| XLogP | 2.93 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|