C25H33NO2 — CID 89115322
(2R,4R,15R,16S,18R)-14-ethyl-15-methyl-15-[(Z)-3-nitrosoprop-1-enyl]hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-en-7-one (PubChem CID 89115322) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (2R,4R,15R,16S,18R)-14-ethyl-15-methyl-15-[(Z)-3-nitrosoprop-1-enyl]hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-en-7-one.
| Compound Name | (2R,4R,15R,16S,18R)-14-ethyl-15-methyl-15-[(Z)-3-nitrosoprop-1-enyl]hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-en-7-one |
|---|---|
| PubChem CID | 89115322 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2R,4R,15R,16S,18R)-14-ethyl-15-methyl-15-[(Z)-3-nitrosoprop-1-enyl]hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-en-7-one |
| SMILES | CCC12CCC3C4CCC(=O)C=C4[C@@H]4C[C@@H]4C3C1C1C[C@@H]1[C@@]2(C)/C=C\CN=O |
| InChI | InChI=1S/C25H33NO2/c1-3-25-9-7-16-15-6-5-14(27)11-17(15)18-12-19(18)22(16)23(25)20-13-21(20)24(25,2)8-4-10-26-28/h4,8,11,15-16,18-23H,3,5-7,9-10,12-13H2,1-2H3/b8-4-/t15?,16?,18-,19-,20?,21-,22?,23?,24+,25?/m0/s1 |
| InChIKey | RHRKROGKWKELPX-WDPNPNNCSA-N |
| XLogP | 5.56 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|