C23H30NO2+ — CID 143827729
(3',7'-dimethyl-5-oxospiro[furan-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene)azanium (PubChem CID 143827729) has the molecular formula C23H30NO2+ and a molecular weight of 352.50 g/mol. Its IUPAC name is (3',7'-dimethyl-5-oxospiro[furan-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene)azanium.
| Compound Name | (3',7'-dimethyl-5-oxospiro[furan-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene)azanium |
|---|---|
| PubChem CID | 143827729 |
| Molecular Formula | C23H30NO2+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (3',7'-dimethyl-5-oxospiro[furan-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene)azanium |
| SMILES | CC12CC1C1(C=CC(=O)O1)C1(C)CCC3C4CCC(=[NH2+])C=C4CCC3C21 |
| InChI | InChI=1S/C23H29NO2/c1-21-12-18(21)23(10-8-19(25)26-23)22(2)9-7-16-15-6-4-14(24)11-13(15)3-5-17(16)20(21)22/h8,10-11,15-18,20,24H,3-7,9,12H2,1-2H3/p+1 |
| InChIKey | MGAZVINYCVEPCF-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|