C26H43N — CID 143827928
but-1-ene;13,17-diethyl-7-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine (PubChem CID 143827928) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is but-1-ene;13,17-diethyl-7-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine.
| Compound Name | but-1-ene;13,17-diethyl-7-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 143827928 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | but-1-ene;13,17-diethyl-7-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
| SMILES | C=CCC.[H]/N=C1/C=C2CC(C)C3C(CCC4(CC)C(CC)CCC34)C2CC1 |
| InChI | InChI=1S/C22H35N.C4H8/c1-4-16-6-9-20-21-14(3)12-15-13-17(23)7-8-18(15)19(21)10-11-22(16,20)5-2;1-3-4-2/h13-14,16,18-21,23H,4-12H2,1-3H3;3H,1,4H2,2H3/b23-17+; |
| InChIKey | ZLOZETKABSPTSC-YFZNFVDXSA-N |
| XLogP | 7.82 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|