C26H39N — CID 143827696
but-1-ene;13-ethenyl-17-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-3-imine (PubChem CID 143827696) has the molecular formula C26H39N and a molecular weight of 365.61 g/mol. Its IUPAC name is but-1-ene;13-ethenyl-17-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-3-imine.
| Compound Name | but-1-ene;13-ethenyl-17-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-3-imine |
|---|---|
| PubChem CID | 143827696 |
| Molecular Formula | C26H39N |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | but-1-ene;13-ethenyl-17-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-3-imine |
| SMILES | C=CCC.[H]/N=C1/C=C2C(CC1)C1CCC3(C=C)C(C)CCC3C1CC21CC1 |
| InChI | InChI=1S/C22H31N.C4H8/c1-3-22-9-8-16-17-6-5-15(23)12-20(17)21(10-11-21)13-18(16)19(22)7-4-14(22)2;1-3-4-2/h3,12,14,16-19,23H,1,4-11,13H2,2H3;3H,1,4H2,2H3/b23-15+; |
| InChIKey | JCQBKNYUWXNVEX-BUGNPGDCSA-N |
| XLogP | 7.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|