C25H32O3 — CID 143827916
CID 143827916 (PubChem CID 143827916) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol.
| Compound Name | CID 143827916 |
|---|---|
| PubChem CID | 143827916 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | — |
| SMILES | CC[C@]12CCC3C4CCC(=O)C=C4C4(CC4)CC3C1C1CC1C21CCC(=O)O1 |
| InChI | InChI=1S/C25H32O3/c1-2-24-7-5-15-16-4-3-14(26)11-19(16)23(9-10-23)13-18(15)22(24)17-12-20(17)25(24)8-6-21(27)28-25/h11,15-18,20,22H,2-10,12-13H2,1H3/t15?,16?,17?,18?,20?,22?,24-,25?/m0/s1 |
| InChIKey | LGYYZZCPRJHGTP-JWHFLMKOSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |