C24H30O3 — CID 90853311
(14S,15S)-14-ethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione (PubChem CID 90853311) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (14S,15S)-14-ethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione.
| Compound Name | (14S,15S)-14-ethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione |
|---|---|
| PubChem CID | 90853311 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (14S,15S)-14-ethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione |
| SMILES | CC[C@]12CCC3C4=C(CC(=O)CC4)C4CC4C3C1C1CC1[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C24H30O3/c1-2-23-7-5-14-13-4-3-12(25)9-15(13)16-10-17(16)21(14)22(23)18-11-19(18)24(23)8-6-20(26)27-24/h14,16-19,21-22H,2-11H2,1H3/t14?,16?,17?,18?,19?,21?,22?,23-,24-/m0/s1 |
| InChIKey | FFRAZLCZFAIMLU-GPRLBBPZSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|