C23H28O3 — CID 91608795
(4S,14S,15S)-14-methylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione (PubChem CID 91608795) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (4S,14S,15S)-14-methylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione.
| Compound Name | (4S,14S,15S)-14-methylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione |
|---|---|
| PubChem CID | 91608795 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (4S,14S,15S)-14-methylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5(10)-ene-15,5'-oxolane]-2',7-dione |
| SMILES | C[C@]12CCC3C4=C(CC(=O)CC4)[C@H]4CC4C3C1C1CC1[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C23H28O3/c1-22-6-4-13-12-3-2-11(24)8-14(12)15-9-16(15)20(13)21(22)17-10-18(17)23(22)7-5-19(25)26-23/h13,15-18,20-21H,2-10H2,1H3/t13?,15-,16?,17?,18?,20?,21?,22+,23+/m1/s1 |
| InChIKey | FMIACKLLUVXELL-IEDZXROYSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|