C26H32O3 — CID 160790886
CID 160790886 (PubChem CID 160790886) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol.
| Compound Name | CID 160790886 |
|---|---|
| PubChem CID | 160790886 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | — |
| SMILES | C[C@]12CC3(CC3)C(=O)C=C1[C@H]1CC1C1C2CC[C@@]2(C)C1C1CC1[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C26H32O3/c1-23-12-25(7-8-25)19(27)11-17(23)13-9-14(13)21-16(23)3-5-24(2)22(21)15-10-18(15)26(24)6-4-20(28)29-26/h11,13-16,18,21-22H,3-10,12H2,1-2H3/t13-,14?,15?,16?,18?,21?,22?,23+,24-,26-/m0/s1 |
| InChIKey | YBINYOJPENETRV-URIAGYEQSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |