C23H33NO2 — CID 89166333
3-[(3E)-3-hydroxyimino-13-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-17-yl]propanal (PubChem CID 89166333) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 3-[(3E)-3-hydroxyimino-13-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-17-yl]propanal.
| Compound Name | 3-[(3E)-3-hydroxyimino-13-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-17-yl]propanal |
|---|---|
| PubChem CID | 89166333 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-[(3E)-3-hydroxyimino-13-methylspiro[1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,1'-cyclopropane]-17-yl]propanal |
| SMILES | CC12CCC3C4CC/C(=N\O)C=C4C4(CC4)CC3C1CCC2CCC=O |
| InChI | InChI=1S/C23H33NO2/c1-22-9-8-17-18-6-5-16(24-26)13-21(18)23(10-11-23)14-19(17)20(22)7-4-15(22)3-2-12-25/h12-13,15,17-20,26H,2-11,14H2,1H3/b24-16+ |
| InChIKey | MGZOTZIVADGYHY-LFVJCYFKSA-N |
| XLogP | 5.37 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|