C20H29NO2 — CID 86594671
(3Z,7S,8R,9S,10R,13S,14S,17S)-7-ethenyl-3-hydroxyimino-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 86594671) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (3Z,7S,8R,9S,10R,13S,14S,17S)-7-ethenyl-3-hydroxyimino-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (3Z,7S,8R,9S,10R,13S,14S,17S)-7-ethenyl-3-hydroxyimino-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 86594671 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (3Z,7S,8R,9S,10R,13S,14S,17S)-7-ethenyl-3-hydroxyimino-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=C[C@@H]1CC2=C/C(=N\O)CC[C@@H]2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C20H29NO2/c1-3-12-10-13-11-14(21-23)4-5-15(13)16-8-9-20(2)17(19(12)16)6-7-18(20)22/h3,11-12,15-19,22-23H,1,4-10H2,2H3/b21-14-/t12-,15+,16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | MAWGVFBOGSOPMH-XLMRFFAFSA-N |
| XLogP | 4.16 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|