C25H32O3 — CID 139756983
(7S,8S,9S,10R,13S,14S,17S)-17-hydroxy-7-(4-methoxyphenyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 139756983) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (7S,8S,9S,10R,13S,14S,17S)-17-hydroxy-7-(4-methoxyphenyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,8S,9S,10R,13S,14S,17S)-17-hydroxy-7-(4-methoxyphenyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 139756983 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (7S,8S,9S,10R,13S,14S,17S)-17-hydroxy-7-(4-methoxyphenyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COc1ccc([C@H]2CC3=CC(=O)CC[C@@H]3[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@@H]32)cc1 |
| InChI | InChI=1S/C25H32O3/c1-25-12-11-20-19-8-5-17(26)13-16(19)14-21(15-3-6-18(28-2)7-4-15)24(20)22(25)9-10-23(25)27/h3-4,6-7,13,19-24,27H,5,8-12,14H2,1-2H3/t19-,20+,21+,22-,23-,24-,25-/m0/s1 |
| InChIKey | SYOPGHQNJMRBSI-ZXSZFVAWSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |