C23H32O5S — CID 90823377
5-[[(7R,8R,9R,10R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid (PubChem CID 90823377) has the molecular formula C23H32O5S and a molecular weight of 420.57 g/mol. Its IUPAC name is 5-[[(7R,8R,9R,10R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid.
| Compound Name | 5-[[(7R,8R,9R,10R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90823377 |
| Molecular Formula | C23H32O5S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 5-[[(7R,8R,9R,10R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](SC(=O)CCCC(=O)O)CC4=CC(=O)CC[C@@H]43)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C23H32O5S/c1-23-10-9-16-15-6-5-14(24)11-13(15)12-18(22(16)17(23)7-8-19(23)25)29-21(28)4-2-3-20(26)27/h11,15-19,22,25H,2-10,12H2,1H3,(H,26,27)/t15-,16+,17-,18+,19-,22+,23-/m0/s1 |
| InChIKey | OBOQLIIUDWNSQF-QEDXJXQGSA-N |
| XLogP | 3.98 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|