C24H32O5S — CID 91148155
5-[[(7R,8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid (PubChem CID 91148155) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is 5-[[(7R,8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid.
| Compound Name | 5-[[(7R,8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91148155 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-[[(7R,8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]-5-oxopentanoic acid |
| SMILES | C[C@]12C=CC(=O)C=C1C[C@@H](SC(=O)CCCC(=O)O)[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C24H32O5S/c1-23-10-8-15(25)12-14(23)13-18(30-21(29)5-3-4-20(27)28)22-16-6-7-19(26)24(16,2)11-9-17(22)23/h8,10,12,16-19,22,26H,3-7,9,11,13H2,1-2H3,(H,27,28)/t16-,17-,18+,19?,22-,23-,24-/m0/s1 |
| InChIKey | BSGBRIIWTHWANT-YNXWCPEISA-N |
| XLogP | 4.15 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|