C23H31N — CID 143827875
7'-ethenyl-6'-methylspiro[cyclopropane-1,17'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-imine (PubChem CID 143827875) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 7'-ethenyl-6'-methylspiro[cyclopropane-1,17'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-imine.
| Compound Name | 7'-ethenyl-6'-methylspiro[cyclopropane-1,17'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-imine |
|---|---|
| PubChem CID | 143827875 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 7'-ethenyl-6'-methylspiro[cyclopropane-1,17'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-imine |
| SMILES | [H]/N=C1/C=C2C(CC1)C1CCC3(C=C)C(C)C4CC4C3C1CC21CC1 |
| InChI | InChI=1S/C23H31N/c1-3-23-7-6-15-16-5-4-14(24)10-20(16)22(8-9-22)12-19(15)21(23)18-11-17(18)13(23)2/h3,10,13,15-19,21,24H,1,4-9,11-12H2,2H3/b24-14+ |
| InChIKey | ZCXXHCRNRMLWRQ-ZVHZXABRSA-N |
| XLogP | 5.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|