C20H30O2 — CID 22791518
(4bS,8aR)-7-acetyl-7,8-diethyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 22791518) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4bS,8aR)-7-acetyl-7,8-diethyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (4bS,8aR)-7-acetyl-7,8-diethyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 22791518 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4bS,8aR)-7-acetyl-7,8-diethyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | CCC1[C@@H]2CCC3=C(CCC(=O)C3)[C@H]2CCC1(CC)C(C)=O |
| InChI | InChI=1S/C20H30O2/c1-4-19-18-8-6-14-12-15(22)7-9-16(14)17(18)10-11-20(19,5-2)13(3)21/h17-19H,4-12H2,1-3H3/t17-,18-,19?,20?/m1/s1 |
| InChIKey | NCBXXVASISZBBA-UVHRUJRTSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|