C23H30O4 — CID 91427008
[(13S)-17-acetyl-6,13-dimethyl-3-oxo-1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 91427008) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is [(13S)-17-acetyl-6,13-dimethyl-3-oxo-1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13S)-17-acetyl-6,13-dimethyl-3-oxo-1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 91427008 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [(13S)-17-acetyl-6,13-dimethyl-3-oxo-1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3C=C(C)C4=C(CCC(=O)C4)C3CC[C@@]21C |
| InChI | InChI=1S/C23H30O4/c1-13-11-20-18(17-6-5-16(26)12-19(13)17)7-9-22(4)21(20)8-10-23(22,14(2)24)27-15(3)25/h11,18,20-21H,5-10,12H2,1-4H3/t18?,20?,21?,22-,23?/m0/s1 |
| InChIKey | OMHXKPKSLLNZLB-OKLQDUTPSA-N |
| XLogP | 4.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |