C26H36O2 — CID 121231015
(13S,17R)-3-ethoxy-13-ethyl-17-ethynyl-17-prop-1-en-2-yloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 121231015) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is (13S,17R)-3-ethoxy-13-ethyl-17-ethynyl-17-prop-1-en-2-yloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (13S,17R)-3-ethoxy-13-ethyl-17-ethynyl-17-prop-1-en-2-yloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 121231015 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (13S,17R)-3-ethoxy-13-ethyl-17-ethynyl-17-prop-1-en-2-yloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C#C[C@]1(OC(=C)C)CCC2C3CC=C4C=C(OCC)CCC4C3CC[C@@]21CC |
| InChI | InChI=1S/C26H36O2/c1-6-25-15-13-22-21-12-10-20(27-8-3)17-19(21)9-11-23(22)24(25)14-16-26(25,7-2)28-18(4)5/h2,9,17,21-24H,4,6,8,10-16H2,1,3,5H3/t21?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | PJOGFMHWOAFSDS-RHFPYEFTSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|