C29H48O2Si — CID 54248031
4-[(8R,9S,10R,13S,14S,17R)-3-ethoxy-13-ethyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-4-enoxy-trimethylsilane (PubChem CID 54248031) has the molecular formula C29H48O2Si and a molecular weight of 457.79 g/mol. Its IUPAC name is 4-[(8R,9S,10R,13S,14S,17R)-3-ethoxy-13-ethyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-4-enoxy-trimethylsilane.
| Compound Name | 4-[(8R,9S,10R,13S,14S,17R)-3-ethoxy-13-ethyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-4-enoxy-trimethylsilane |
|---|---|
| PubChem CID | 54248031 |
| Molecular Formula | C29H48O2Si |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.35 |
| IUPAC Name | 4-[(8R,9S,10R,13S,14S,17R)-3-ethoxy-13-ethyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-4-enoxy-trimethylsilane |
| SMILES | C=C(CCC[17O][Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(OCC)CC[C@@H]4[C@H]3CC[C@]12CC |
| InChI | InChI=1S/C29H48O2Si/c1-7-29-18-17-25-24-14-12-23(30-8-2)20-22(24)11-13-26(25)28(29)16-15-27(29)21(3)10-9-19-31-32(4,5)6/h11,20,24-28H,3,7-10,12-19H2,1-2,4-6H3/t24-,25+,26+,27+,28-,29+/m0/s1/i31+1 |
| InChIKey | QURRWPQBIYQMTA-WDEQVOEOSA-N |
| XLogP | 8.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|