C24H34O2 — CID 67546891
(1R,2R,3S,5S,6S,7S,10S,11R)-7-ethyl-14-methoxy-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol (PubChem CID 67546891) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (1R,2R,3S,5S,6S,7S,10S,11R)-7-ethyl-14-methoxy-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol.
| Compound Name | (1R,2R,3S,5S,6S,7S,10S,11R)-7-ethyl-14-methoxy-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol |
|---|---|
| PubChem CID | 67546891 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (1R,2R,3S,5S,6S,7S,10S,11R)-7-ethyl-14-methoxy-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol |
| SMILES | C=CC[C@]1(O)[C@H]2C[C@H]2[C@H]2[C@@H]3CC=C4C=C(OC)CC[C@@H]4[C@H]3CC[C@@]21CC |
| InChI | InChI=1S/C24H34O2/c1-4-11-24(25)21-14-20(21)22-19-8-6-15-13-16(26-3)7-9-17(15)18(19)10-12-23(22,24)5-2/h4,6,13,17-22,25H,1,5,7-12,14H2,2-3H3/t17-,18+,19+,20+,21-,22+,23-,24-/m0/s1 |
| InChIKey | BVAAOZYWLPGCOF-UKWHWBIXSA-N |
| XLogP | 5.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|