C23H35NO3 — CID 166716148
3-ethoxy-13-ethyl-11,17-dimethyl-17-nitroso-1,2,7,8,9,10,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-ol (PubChem CID 166716148) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 3-ethoxy-13-ethyl-11,17-dimethyl-17-nitroso-1,2,7,8,9,10,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-ol.
| Compound Name | 3-ethoxy-13-ethyl-11,17-dimethyl-17-nitroso-1,2,7,8,9,10,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 166716148 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 3-ethoxy-13-ethyl-11,17-dimethyl-17-nitroso-1,2,7,8,9,10,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-ol |
| SMILES | CCOC1=CC2=CCC3C(C2CC1)C(C)(O)CC1(CC)C3CCC1(C)N=O |
| InChI | InChI=1S/C23H35NO3/c1-5-23-14-21(3,25)20-17-10-8-16(27-6-2)13-15(17)7-9-18(20)19(23)11-12-22(23,4)24-26/h7,13,17-20,25H,5-6,8-12,14H2,1-4H3 |
| InChIKey | MZZCNSLZNWUALO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |